B urolitina hautsa

Azaroaren 9, 2020

Cofttek Urolithin B hauts fabrikatzaile onena da Txinan. Gure fabrikak produkzioa kudeatzeko sistema osoa du (ISO9001 eta ISO14001), hilean 200 kg-ko ekoizpen-ahalmena duena.

 


Status: Mass ekoizpenean
Unitatea: 1kg / poltsa, 25kg / Danborra

Urolitina BSpecifications

Izena: Urolitina B
Izena kimikoa: 3-hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula kimikoa: C13H8O3
Pisu molekularra: X
Kolorea:  Hauts White
InChi gakoa: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Kodea: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funtzioa: B urolitina mitokondriala eta giharren funtzioa hobetu dezake.

B urolitinak muskulu indarra eta erresistentzia hobetzen ditu zahartzean.

Aplikazio: B urolitina ellagitannisen hesteetako mikrobio metabolitoa da eta oxidazio anti-oxidatzaile eta pro-oxidatzaile aktibo indartsuak erakusten ditu, azterketa sistemaren eta baldintzen arabera. B urolitinak jarduera estrogenikoa eta / edo estrogenikoa ere erakutsi ditzake.
disolbagarritasuna: Erraz disolbagarria da N, N-dimetilformamidan eta dimetilmetilenan. Sulfona, disolbagarria apur bat metanol, etanol eta etil azetatoan
Biltegiratze tenporala: Higroskopikoa, -20 ° C izozkailua, giro inertik gabe
Bidalketa-baldintza: Giro-tenperaturan girotzean kimiko ez arriskutsuak direnez. Produktu hau aste gutxiren buruan egon daiteke nahikoa ohiko bidalketetan eta denboran zehar.

 

Urolitina B RMN espektroa

B urolitina (1139-83-9) - RMN espektroa

 

Produktu sorta bakoitzeko eta bestelako informazioa COA, MSDS, HNMR behar baduzu, jarri gurekin harremanetan marketin zuzendaria.

 

Urolitinei buruzko sarrera

Urolitinak elagitaninetatik eratorritako azido elagikoaren bigarren metabolitoak dira. Gizakietan elagitaninak hesteetako mikroflora azido elagiko bihurtzen dira, heste lodietan A, urolitina B, C urolitina eta D urolitina bihurtzen direnak.

A urolitina (UA) ellagitaninen metabolito nagusia da. Hala ere, ez da ezagutzen A urolitina modu naturalean gertatzen dela dieta iturrietan.

B urolitina (UB) ellagitaninen eraldaketaren bidez hestean sortzen den metabolito ugaria da. Urolitina B da azken produktua, urolitinaren beste deribatu guztiak katabolizatu ondoren. B urolitina gernuan urolitina B glukuronido gisa aurkitzen da.

A 8-metil eter Urolitina tarteko produktua da Urolitina A. sintetizatzerakoan. Elagitaninaren bigarren metabolito esanguratsua da eta propietate antioxidatzaileak eta antiinflamatorioak ditu.

 

A eta B urolitinaren ekintza mekanismoa

● A Urolitinak mitofagia eragiten du

Mitofagia autofagia mota bat da, kaltetutako mitokondrioak kentzen laguntzen baitu bere funtzionamendu egokirako. Autofagia, prozesu zitoplasmikoak degradatzen diren eta, ondorioz, birziklatzen diren prozesu orokorra aipatzen da, mitofagia mitokondriaren degradazioa eta birziklapena den bitartean.

Zahartzean autofagia gutxitzea da funtzio mitokondrialaren beherakada eragiten duen alderdia. Gainera, estres oxidatiboak autofagia txikia ere ekar dezake. A Urolitina kaltetutako mitokondrioak autofagia selektiboaren bidez kentzeko gaitasuna du.

● Propietate antioxidatzaileak

Estres oxidatzailea gorputzean erradikal askeen eta antioxidatzaileen arteko desoreka gertatzen da. Gehiegizko erradikal aske horiek gaixotasun kroniko ugarirekin lotzen dira maiz: bihotzeko arazoak, diabetesa eta minbizia.

A eta B urolitinek efektu antioxidatzaileak agertzen dituzte erradikal askeak eta zehazki zelulen oxigeno espezie erreaktiboak (ROS) murrizteko duten gaitasunaren bidez eta zelula mota jakin batzuetan lipidoen peroxidazioa ere inhibitzen dute.

Gainera, urolitinak zenbait entzima oxidatzaile inhibitzeko gai dira, A monoaminoxidasa eta tirosinasa barne.

● Hanturaren aurkako propietateak

Hantura gure gorputzak eroritako edozein gauzaren aurka borrokatzen duen prozesu naturala da, hala nola infekzioak, lesioak eta mikrobioak. Hala ere, hantura kronikoa kaltegarria izan daiteke gorputzarentzat, asma, bihotzeko arazoak eta minbizia bezalako hainbat nahasteekin lotzen baita. Hantura kronikoa gerta liteke tratatu gabeko hantura akutua, infekzioak edo gorputzeko erradikal askeak direla eta.

A eta B urolitinek hanturaren aurkako propietateak agertzen dituzte oxido nitrikoaren produkzioa inhibituz. Berariaz inhibitzen dute oxido nitriko sintetiko induziblea (iNOS) proteina eta mRNA adierazpena, hanturaz arduratzen direnak.

● Mikrobioen aurkako efektuak

Bakterioak, onddoak eta birusak dituzten mikrobioak ingurunean eta baita gizakiaren gorputzean ere gertatzen dira. Hala ere, patogenoak aipatzen diren mikrobio batzuek gaixotasun infekziosoak eragin ditzakete, hala nola gripea, elgorria eta malaria.

Urolitina A eta B mikrobioen jarduera erakusteko gai dira quorum sentsazioa inhibituz. Koroiaren sentsazioa bakterioen komunikazio modu bat da, bakterioek infekzioarekin lotutako prozesuak detektatu eta kontrolatzeko aukera ematen dutenak, hala nola, biolentzia eta mugikortasuna.

● Proteinen glikazioa inhibitzea

Glikazioari azukrea lipido edo proteina bati atxikimendu ez entzimatiko bat aipatzen da. Gaixotasun biomarkatzailea da diabetesa eta bestelako nahasteak zahartzeaz gain.

Proteina glicationa hipergluzemiaren bigarren mailako efektua da, eta kardiobaskularrekin lotutako arazoak nahasten ditu, hala nola diabetesa eta Alzheimer gaixotasuna.

A eta B urolitinak propietate anti-glikatiboak dituzte, beren jarduera antioxidatzaileengandik independienteki diren dosia dutenak.

 

Urolitinaren B onurak

B urolitinaren osagarriek osasunerako hainbat onura ere badituzte eta gehienak A urolitinaren abantailen antzekoak dira.

(1) Minbiziaren aurkako potentziala
Urolitina Bren aurkako hanturazko propietateak minbiziaren aurka borrokatzeko hautagai ona dira. Zenbait ikertzailek fibroblastoetan, mikrofagoetan eta endotelio zeluletan izan duten potentzialaren berri eman dute.

Ikerketek jakinarazi dute UB-k minbizi mota ezberdinak inhibitzen dituela, esate baterako, prostata, kolon eta maskuriko minbizia.

Giza koloneko minbizia duten zelulen inguruko ikerketa batean, elagitanninak, azido ellagikoa eta A eta B urolitinak minbiziaren aurkako potentzialtasuna ebaluatu ziren. Tratamendu guztiek minbizi zelulen hazkundea inhibitzeko gai zirela jakinarazi zuten. Minbizi-zelulen ugaritzea inhibitu zuten zelula-zikloaren atxiloketa fase desberdinetan eta, gainera, apoptosia eraginez.

(2) Estres oxidatiboaren aurka borrokatzen lagun dezake
B urolitinak propietate antioxidatzaile bikainak ditu oxigeno espezieen maila erreaktiboak murrizten eta lipidoen peroxidazioa zenbait zelula motatan. ROS maila altuak Alzheimer gaixotasuna bezalako nahaste askorekin lotzen dira.

Estres oxidatiboaren eraginpean dauden zelulen neuronalei egindako ikerketan, urolitina B osagarria eta A urolitina ere aurkitu ziren zelulak oxidazioen aurka babesteko, beraz, zelulen biziraupena areagotu zen.

(3) Urolitina B memoria hobetzeko
Odol-hesiaren iragazkortasuna hobetzen dela jakinarazi da urolitina b. Honek funtzionamendu kognitiboa hobetzen du.

Ikerketek frogatu dutenez, urolitina B balizko memoria indartzailea izan daiteke funtzionamendu kognitibo orokorra hobetuz.

(4) Giharrak galtzea ekiditen du
Muskuluen galera hainbat arrazoirengatik gerta daiteke, besteak beste, nahasteak, zahartzea eta dietetan proteinen gabezia. Giharrak galtzea saihesteko, mugatzeko edo hobetzeko hainbat neurri barne, ariketa, drogak eta aminoazidoak eta polifenolak erabil daitezke.

Urolitinak polifenolak bezala sailka daitezke eta giharrak galtzea ekidin dezakete gihar proteinen sintesia aktibatuz eta degradazioa murriztuz.

Saguekin egindako ikerketa batean, Urolitina B osagarriak denboraldi batean zehar administratutako muskuluen garapena hobetzen ari zela ikusi zen, giharrak handiagoak zirenez.

(5) B urolitinak hanturaren aurka borrokatzen du
B urolitinak hanturaren aurkako propietateak ditu hanturaren markatzaile gehienak murriztuz.

Giltzurruneko fibrosi eragindako arratoien azterketan, B urolitina giltzurruneko lesioa hobetzen zela aurkitu zen. Giltzurruneko funtzioa hobetu zuen, giltzurrunaren morfologia eta giltzurruneko lesioen markatzaileak murriztu zituen. Horrek adierazten du UB giltzurrunetako hanturak arintzeko gai zela.

(6) A eta B urolitinaren abantaila sinergikoak
A eta B urolitinaren konbinazioan efektu sinergikoak ere jakinarazi dira funtzio eta ahalmen kognitiboan. Ikerketak adierazi zuen konbinazio hori dementziarekin lotutako antsietatea edo Alzheimer nahastea bezalako tratu txarrak tratatzeko edo prebenitzeko erabil daitekeela.

Urolitinei lotutako beste abantaila hauek dira;

  • neuroprotection
  • Sindrome metabolikoa hobetzen du

 

Urolitina A eta B elikagai iturriak

Ez da ezagutzen urolitinak modu naturalean aurki daitezkeen dieta iturririk. Elagitanninetatik eratorritako azido elagikoen eraldaketaren produktua dira. Ellagitanninak azido elagikoetan bihurtzen dira hesteetako mikrobiotak eta azido elagikoa gehiago bihurtzen da bere metabolitoetan (urolitinak) heste handietan.

Elagitanninak modu naturalean agertzen dira elikagai iturrietan, hala nola granadak, baia marrubiak, mugurdiak, masustak eta masustak, muscadine mahatsa, almendra, goiaba, tea eta fruitu lehorrak, hala nola, intxaurrak eta gaztainak, baita haritz-adineko edariak ere, adibidez ardo beltza eta whiskia. haritz upelak.

Horregatik ondoriozta dezakegu A urolitina eta B urolitina elikagaiak ellagitanina ugari duten elikagaiak direla. Nabarmentzekoa da elagitaninaren biodisponibilitatea oso mugatua dela, bere bigarren metabolitoak (urolitinak) erraz eskuragarri dauden bitartean.

Urolitinak kanporatzea eta ekoiztea asko aldatzen dira gizabanakoen artean, elagitaninetatik bihurtzea hesteetako mikrobiotan oinarritzen baita. Bihurketa horretan parte hartzen duten bakterio espezifikoak daude eta zenbait mikrobiota egokia, baxua edo erabilgarri ez duten pertsonen artean aldatzen dira. Janari iturriak ere aldatu egiten dira elagitaninoen mailan. Horregatik, ellagitaninoen balizko onurak gizabanako batetik bestera aldatzen dira.

 

A eta B urolitina osagarriak

Urolithin A osagarriak eta Urolithin B osagarriak merkatuan aurki daitezke elagitananina aberatsa duten elikagai iturrien osagarri gisa. A Urolithin osagarriak ere eskuragarri daude. Granada osagarriak saldu eta arrakastaz erabili dira gehienetan. Osagarri hauek fruituetatik edo fruitu lehorretatik sintetizatzen dira eta likido edo hauts moduan formulatzen dira.

Elikitaninoen elikagaien kontzentrazioaren aldakuntzak direla eta, urolitinaren bezeroek elikagai iturria kontuan hartuta erosten dute. Gauza bera gertatzen da B urolitina hautsa edo osagarri likidoak eskuratzerakoan.

A urolitina hautsarekin edo B-rekin egindako ikerketa kliniko bakanek ez dute osagarri horiek administratzearen bigarren mailako efektu larririk jakinarazi.

Erreferentzia

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). "Elagitanninen patu metabolikoa: osasunerako inplikazioak eta elikagai funtzional berritzaileentzako ikerketen ikuspuntuak". Iritzi kritikoak Elikagaien Zientzian eta Nutrizioan.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11ko azaroaren 2009). "Urolitinak, Granadako ellagitaninen hesteetako mikrobioen metabolitoak, jarduera antioxidatzaile indartsua erakusten dute zeluletan oinarritutako azterketan". J Agric Food Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). "Alderantzizko elektroi-eskaera Diels-Alder oinarritutako Urolithin M7 sintesi osoa".