Urolitina B (1139-83-9) Fabrikatzailearen fabrika

Urolitina B

Azaroaren 9, 2020

Urolitina BSpecifications

Izena: Urolitina B
Izena kimikoa: 3-hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Formula kimikoa: C13H8O3
Pisu molekularra: X
Kolorea:  Hauts White
InChi gakoa: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Kodea: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funtzioa: B urolitina mitokondriala eta giharren funtzioa hobetu dezake.

B urolitinak muskulu indarra eta erresistentzia hobetzen ditu zahartzean.

Aplikazio: B urolitina ellagitannisen hesteetako mikrobio metabolitoa da eta oxidazio anti-oxidatzaile eta pro-oxidatzaile aktibo indartsuak erakusten ditu, azterketa sistemaren eta baldintzen arabera. B urolitinak jarduera estrogenikoa eta / edo estrogenikoa ere erakutsi ditzake.
disolbagarritasuna: Erraz disolbagarria da N, N-dimetilformamidan eta dimetilmetilenan. Sulfona, disolbagarria apur bat metanol, etanol eta etil azetatoan
Biltegiratze tenporala: Higroskopikoa, -20 ° C izozkailua, giro inertik gabe
Bidalketa-baldintza: Giro-tenperaturan girotzean kimiko ez arriskutsuak direnez. Produktu hau aste gutxiren buruan egon daiteke nahikoa ohiko bidalketetan eta denboran zehar.